C14H11N5OS2 — CID 135615709
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile (PubChem CID 135615709) has the molecular formula C14H11N5OS2 and a molecular weight of 329.41 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135615709 |
| Molecular Formula | C14H11N5OS2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enenitrile |
| SMILES | Cn1cnnc1SC/C(O)=C(\C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11N5OS2/c1-19-8-16-18-14(19)21-7-11(20)9(6-15)13-17-10-4-2-3-5-12(10)22-13/h2-5,8,20H,7H2,1H3/b11-9- |
| InChIKey | TZGOKMQCJPIFBU-LUAWRHEFSA-N |
| XLogP | 3.01 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|