C20H14N4O2S2 — CID 135766833
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enenitrile (PubChem CID 135766833) has the molecular formula C20H14N4O2S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135766833 |
| Molecular Formula | C20H14N4O2S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]but-2-enenitrile |
| SMILES | Cc1ccccc1-c1nnc(SC/C(O)=C(\C#N)c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C20H14N4O2S2/c1-12-6-2-3-7-13(12)18-23-24-20(26-18)27-11-16(25)14(10-21)19-22-15-8-4-5-9-17(15)28-19/h2-9,25H,11H2,1H3/b16-14- |
| InChIKey | AXGIMHBXFVBNGD-PEZBUJJGSA-N |
| XLogP | 5.24 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|