C20H14BrN5O2S — CID 137258743
(Z)-4-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 137258743) has the molecular formula C20H14BrN5O2S and a molecular weight of 468.34 g/mol. Its IUPAC name is (Z)-4-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 137258743 |
| Molecular Formula | C20H14BrN5O2S |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | (Z)-4-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C(\O)CSc2nnc(-c3ccccc3Br)o2)nc2ccccc21 |
| InChI | InChI=1S/C20H14BrN5O2S/c1-26-16-9-5-4-8-15(16)23-18(26)13(10-22)17(27)11-29-20-25-24-19(28-20)12-6-2-3-7-14(12)21/h2-9,27H,11H2,1H3/b17-13- |
| InChIKey | LQOAQVMXIYZBMW-LGMDPLHJSA-N |
| XLogP | 4.97 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|