C21H18N6OS — CID 137103733
3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile (PubChem CID 137103733) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile.
| Compound Name | 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 137103733 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-hydroxy-2-(1-methylbenzimidazol-2-yl)-4-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enenitrile |
| SMILES | Cc1ccccc1-n1cnnc1SCC(O)=C(C#N)c1nc2ccccc2n1C |
| InChI | InChI=1S/C21H18N6OS/c1-14-7-3-5-9-17(14)27-13-23-25-21(27)29-12-19(28)15(11-22)20-24-16-8-4-6-10-18(16)26(20)2/h3-10,13,28H,12H2,1-2H3 |
| InChIKey | XKBZKYCNWSQSAW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|