C27H21N5O2S — CID 137317972
(Z)-4-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile (PubChem CID 137317972) has the molecular formula C27H21N5O2S and a molecular weight of 479.57 g/mol. Its IUPAC name is (Z)-4-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile.
| Compound Name | (Z)-4-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 137317972 |
| Molecular Formula | C27H21N5O2S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (Z)-4-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-3-hydroxy-2-(1-methylbenzimidazol-2-yl)but-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C(\O)CSc2nc3ccccc3c(=O)n2Cc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C27H21N5O2S/c1-31-23-14-8-7-13-22(23)29-25(31)20(15-28)24(33)17-35-27-30-21-12-6-5-11-19(21)26(34)32(27)16-18-9-3-2-4-10-18/h2-14,33H,16-17H2,1H3/b24-20- |
| InChIKey | JEEIOLRUSGPXRZ-GFMRDNFCSA-N |
| XLogP | 4.92 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|