C19H15N5OS — CID 3247481
2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(1-methylbenzimidazol-2-yl)sulfanylbut-2-enenitrile (PubChem CID 3247481) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(1-methylbenzimidazol-2-yl)sulfanylbut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(1-methylbenzimidazol-2-yl)sulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 3247481 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(1-methylbenzimidazol-2-yl)sulfanylbut-2-enenitrile |
| SMILES | Cn1c(SCC(O)=C(C#N)c2nc3ccccc3[nH]2)nc2ccccc21 |
| InChI | InChI=1S/C19H15N5OS/c1-24-16-9-5-4-8-15(16)23-19(24)26-11-17(25)12(10-20)18-21-13-6-2-3-7-14(13)22-18/h2-9,25H,11H2,1H3,(H,21,22) |
| InChIKey | SLFJCOKSQYGNPJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|