C20H17N7O2S — CID 4036503
2-(1H-benzimidazol-2-yl)-4-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-3-hydroxybut-2-enenitrile (PubChem CID 4036503) has the molecular formula C20H17N7O2S and a molecular weight of 419.47 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 4036503 |
| Molecular Formula | C20H17N7O2S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-3-hydroxybut-2-enenitrile |
| SMILES | CCOc1ccccc1-n1nnnc1SCC(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H17N7O2S/c1-2-29-18-10-6-5-9-16(18)27-20(24-25-26-27)30-12-17(28)13(11-21)19-22-14-7-3-4-8-15(14)23-19/h3-10,28H,2,12H2,1H3,(H,22,23) |
| InChIKey | YMMOLMVKFZISBW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|