C19H12F3N7O2S — CID 135599340
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylbut-2-enenitrile (PubChem CID 135599340) has the molecular formula C19H12F3N7O2S and a molecular weight of 459.41 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylbut-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 135599340 |
| Molecular Formula | C19H12F3N7O2S |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylbut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nnnn1-c1ccc(OC(F)(F)F)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H12F3N7O2S/c20-19(21,22)31-12-7-5-11(6-8-12)29-18(26-27-28-29)32-10-16(30)13(9-23)17-24-14-3-1-2-4-15(14)25-17/h1-8,30H,10H2,(H,24,25)/b16-13- |
| InChIKey | AFRRHGXIFXYPFP-SSZFMOIBSA-N |
| XLogP | 4.02 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|