C25H17ClN6OS — CID 5094553
2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 5094553) has the molecular formula C25H17ClN6OS and a molecular weight of 484.97 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 5094553 |
| Molecular Formula | C25H17ClN6OS |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1nnc(-c2ccccc2)n1-c1ccc(Cl)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H17ClN6OS/c26-17-10-12-18(13-11-17)32-24(16-6-2-1-3-7-16)30-31-25(32)34-15-22(33)19(14-27)23-28-20-8-4-5-9-21(20)29-23/h1-13,33H,15H2,(H,28,29) |
| InChIKey | RUTFYUHVPPXWIW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|