C22H19ClN6O2S — CID 2409225
2-(1H-benzimidazol-2-yl)-4-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 2409225) has the molecular formula C22H19ClN6O2S and a molecular weight of 466.95 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 2409225 |
| Molecular Formula | C22H19ClN6O2S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[[5-(4-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | COCCn1c(SCC(O)=C(C#N)c2nc3ccccc3[nH]2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClN6O2S/c1-31-11-10-29-21(14-6-8-15(23)9-7-14)27-28-22(29)32-13-19(30)16(12-24)20-25-17-4-2-3-5-18(17)26-20/h2-9,30H,10-11,13H2,1H3,(H,25,26) |
| InChIKey | JMSNMSWVLVRPQP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|