C28H25N7O2S — CID 135736508
(Z)-2-(1H-benzimidazol-2-yl)-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enenitrile;N,N-dimethylformamide (PubChem CID 135736508) has the molecular formula C28H25N7O2S and a molecular weight of 523.62 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enenitrile;N,N-dimethylformamide.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enenitrile;N,N-dimethylformamide |
|---|---|
| PubChem CID | 135736508 |
| Molecular Formula | C28H25N7O2S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-3-hydroxybut-2-enenitrile;N,N-dimethylformamide |
| SMILES | CN(C)C=O.N#C/C(=C(/O)CSc1nnc(-c2ccccc2)n1-c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H18N6OS.C3H7NO/c26-15-19(23-27-20-13-7-8-14-21(20)28-23)22(32)16-33-25-30-29-24(17-9-3-1-4-10-17)31(25)18-11-5-2-6-12-18;1-4(2)3-5/h1-14,32H,16H2,(H,27,28);3H,1-2H3/b22-19-; |
| InChIKey | QQDRHGDHPPHPAT-GXTSIBQPSA-N |
| XLogP | 5.10 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|