C23H24N8O3S — CID 135691214
(Z)-4-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile;N,N-dimethylformamide (PubChem CID 135691214) has the molecular formula C23H24N8O3S and a molecular weight of 492.57 g/mol. Its IUPAC name is (Z)-4-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile;N,N-dimethylformamide.
| Compound Name | (Z)-4-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile;N,N-dimethylformamide |
|---|---|
| PubChem CID | 135691214 |
| Molecular Formula | C23H24N8O3S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (Z)-4-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile;N,N-dimethylformamide |
| SMILES | CN(C)C=O.COc1ccccc1-c1nnc(SC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)n1N |
| InChI | InChI=1S/C20H17N7O2S.C3H7NO/c1-29-17-9-5-2-6-12(17)19-25-26-20(27(19)22)30-11-16(28)13(10-21)18-23-14-7-3-4-8-15(14)24-18;1-4(2)3-5/h2-9,28H,11,22H2,1H3,(H,23,24);3H,1-2H3/b16-13-; |
| InChIKey | MQJAFHULVWPYSY-UNVLYCKESA-N |
| XLogP | 2.83 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|