C24H19N7OS — CID 135466166
(Z)-4-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile (PubChem CID 135466166) has the molecular formula C24H19N7OS and a molecular weight of 453.53 g/mol. Its IUPAC name is (Z)-4-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-4-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135466166 |
| Molecular Formula | C24H19N7OS |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (Z)-4-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nnc(Cc2cccc3ccccc23)n1N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H19N7OS/c25-13-18(23-27-19-10-3-4-11-20(19)28-23)21(32)14-33-24-30-29-22(31(24)26)12-16-8-5-7-15-6-1-2-9-17(15)16/h1-11,32H,12,14,26H2,(H,27,28)/b21-18- |
| InChIKey | ISHQVRNNUFSQRF-UZYVYHOESA-N |
| XLogP | 4.20 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|