C13H10N6OS2 — CID 135466338
(Z)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile (PubChem CID 135466338) has the molecular formula C13H10N6OS2 and a molecular weight of 330.40 g/mol. Its IUPAC name is (Z)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135466338 |
| Molecular Formula | C13H10N6OS2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (Z)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)CSc1nnc(N)s1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H10N6OS2/c14-5-7(10(20)6-21-13-19-18-12(15)22-13)11-16-8-3-1-2-4-9(8)17-11/h1-4,20H,6H2,(H2,15,18)(H,16,17)/b10-7- |
| InChIKey | PDFOZLAIYUHCKY-YFHOEESVSA-N |
| XLogP | 2.58 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|