C15H13N5OS2 — CID 135702789
(Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pent-2-enenitrile (PubChem CID 135702789) has the molecular formula C15H13N5OS2 and a molecular weight of 343.44 g/mol. Its IUPAC name is (Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pent-2-enenitrile.
| Compound Name | (Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 135702789 |
| Molecular Formula | C15H13N5OS2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pent-2-enenitrile |
| SMILES | Cc1nnc(S[C@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C15H13N5OS2/c1-8(22-15-20-19-9(2)23-15)13(21)10(7-16)14-17-11-5-3-4-6-12(11)18-14/h3-6,8,21H,1-2H3,(H,17,18)/b13-10-/t8-/m1/s1 |
| InChIKey | RWDWUIKBJBYPGM-ZGFGWORNSA-N |
| XLogP | 3.70 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|