C19H20N6O2S2 — CID 137090196
2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile (PubChem CID 137090196) has the molecular formula C19H20N6O2S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 137090196 |
| Molecular Formula | C19H20N6O2S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile |
| SMILES | CC(Sc1nnc(NCC2CCCO2)s1)C(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H20N6O2S2/c1-11(28-19-25-24-18(29-19)21-10-12-5-4-8-27-12)16(26)13(9-20)17-22-14-6-2-3-7-15(14)23-17/h2-3,6-7,11-12,26H,4-5,8,10H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | CFXVLILTGIMBIV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|