C18H20N6OS2 — CID 137258757
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile (PubChem CID 137258757) has the molecular formula C18H20N6OS2 and a molecular weight of 400.53 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 137258757 |
| Molecular Formula | C18H20N6OS2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pent-2-enenitrile |
| SMILES | CC(C)CNc1nnc(SC(C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C18H20N6OS2/c1-10(2)9-20-17-23-24-18(27-17)26-11(3)15(25)12(8-19)16-21-13-6-4-5-7-14(13)22-16/h4-7,10-11,25H,9H2,1-3H3,(H,20,23)(H,21,22)/b15-12- |
| InChIKey | MAPUXSDWIMBSGK-QINSGFPZSA-N |
| XLogP | 4.46 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|