C18H19N7OS — CID 135883993
(Z)-2-(1H-benzimidazol-2-yl)-4-(1-cyclopentyltetrazol-5-yl)sulfanyl-3-hydroxypent-2-enenitrile (PubChem CID 135883993) has the molecular formula C18H19N7OS and a molecular weight of 381.47 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-(1-cyclopentyltetrazol-5-yl)sulfanyl-3-hydroxypent-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-(1-cyclopentyltetrazol-5-yl)sulfanyl-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135883993 |
| Molecular Formula | C18H19N7OS |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-(1-cyclopentyltetrazol-5-yl)sulfanyl-3-hydroxypent-2-enenitrile |
| SMILES | CC(Sc1nnnn1C1CCCC1)/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H19N7OS/c1-11(27-18-22-23-24-25(18)12-6-2-3-7-12)16(26)13(10-19)17-20-14-8-4-5-9-15(14)21-17/h4-5,8-9,11-12,26H,2-3,6-7H2,1H3,(H,20,21)/b16-13- |
| InChIKey | YFFMWOYMHARBFV-SSZFMOIBSA-N |
| XLogP | 3.64 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|