C22H17N7OS — CID 137309150
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]pent-2-enenitrile (PubChem CID 137309150) has the molecular formula C22H17N7OS and a molecular weight of 427.49 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]pent-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 137309150 |
| Molecular Formula | C22H17N7OS |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2-methyl-[1,2,4]triazolo[1,5-c]quinazolin-5-yl)sulfanyl]pent-2-enenitrile |
| SMILES | Cc1nc2c3ccccc3nc(SC(C)/C(O)=C(\C#N)c3nc4ccccc4[nH]3)n2n1 |
| InChI | InChI=1S/C22H17N7OS/c1-12(19(30)15(11-23)20-25-17-9-5-6-10-18(17)26-20)31-22-27-16-8-4-3-7-14(16)21-24-13(2)28-29(21)22/h3-10,12,30H,1-2H3,(H,25,26)/b19-15- |
| InChIKey | KPRKXIBDPAPKPL-CYVLTUHYSA-N |
| XLogP | 4.44 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|