C19H14ClN7OS — CID 137294611
(Z)-2-(1H-benzimidazol-2-yl)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-3-hydroxypent-2-enenitrile (PubChem CID 137294611) has the molecular formula C19H14ClN7OS and a molecular weight of 423.89 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-3-hydroxypent-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 137294611 |
| Molecular Formula | C19H14ClN7OS |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-4-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-3-hydroxypent-2-enenitrile |
| SMILES | CC(Sc1nnnn1-c1ccc(Cl)cc1)/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H14ClN7OS/c1-11(29-19-24-25-26-27(19)13-8-6-12(20)7-9-13)17(28)14(10-21)18-22-15-4-2-3-5-16(15)23-18/h2-9,11,28H,1H3,(H,22,23)/b17-14- |
| InChIKey | WKUUSEYICVFSTE-VKAVYKQESA-N |
| XLogP | 4.17 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|