C20H16ClN3O3S — CID 137122983
2-(1H-benzimidazol-2-yl)-4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-3-hydroxypent-2-enenitrile (PubChem CID 137122983) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-3-hydroxypent-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 137122983 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-4-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)sulfanyl]-3-hydroxypent-2-enenitrile |
| SMILES | CC(Sc1cc2c(cc1Cl)OCCO2)C(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H16ClN3O3S/c1-11(28-18-9-17-16(8-13(18)21)26-6-7-27-17)19(25)12(10-22)20-23-14-4-2-3-5-15(14)24-20/h2-5,8-9,11,25H,6-7H2,1H3,(H,23,24) |
| InChIKey | ABUPZQMVTVFISV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|