C22H22ClN5O — CID 135779678
(Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(2-chlorophenyl)piperazin-1-yl]-3-hydroxypent-2-enenitrile (PubChem CID 135779678) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is (Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(2-chlorophenyl)piperazin-1-yl]-3-hydroxypent-2-enenitrile.
| Compound Name | (Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(2-chlorophenyl)piperazin-1-yl]-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135779678 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(2-chlorophenyl)piperazin-1-yl]-3-hydroxypent-2-enenitrile |
| SMILES | C[C@@H](/C(O)=C(\C#N)c1nc2ccccc2[nH]1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H22ClN5O/c1-15(27-10-12-28(13-11-27)20-9-5-2-6-17(20)23)21(29)16(14-24)22-25-18-7-3-4-8-19(18)26-22/h2-9,15,29H,10-13H2,1H3,(H,25,26)/b21-16-/t15-/m0/s1 |
| InChIKey | LEYQFCUCHKAZRH-UFPHYQGISA-N |
| XLogP | 4.22 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|