C18H21N5O2 — CID 135625217
(Z,4S)-4-(4-acetylpiperazin-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile (PubChem CID 135625217) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (Z,4S)-4-(4-acetylpiperazin-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile.
| Compound Name | (Z,4S)-4-(4-acetylpiperazin-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135625217 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (Z,4S)-4-(4-acetylpiperazin-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile |
| SMILES | CC(=O)N1CCN([C@@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H21N5O2/c1-12(22-7-9-23(10-8-22)13(2)24)17(25)14(11-19)18-20-15-5-3-4-6-16(15)21-18/h3-6,12,25H,7-10H2,1-2H3,(H,20,21)/b17-14-/t12-/m0/s1 |
| InChIKey | SWSVYGUETDQALH-SEQUMDBASA-N |
| XLogP | 1.91 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|