C15H15N3O3S — CID 137218009
methyl 2-[4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylacetate (PubChem CID 137218009) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is methyl 2-[4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 137218009 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | methyl 2-[4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSC(C)C(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H15N3O3S/c1-9(22-8-13(19)21-2)14(20)10(7-16)15-17-11-5-3-4-6-12(11)18-15/h3-6,9,20H,8H2,1-2H3,(H,17,18) |
| InChIKey | QNZMEIBBRFUEAD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|