C20H18N4O2S — CID 135798294
N-[4-[(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylphenyl]acetamide (PubChem CID 135798294) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[4-[(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 135798294 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[4-[(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S[C@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H18N4O2S/c1-12(27-15-9-7-14(8-10-15)22-13(2)25)19(26)16(11-21)20-23-17-5-3-4-6-18(17)24-20/h3-10,12,26H,1-2H3,(H,22,25)(H,23,24)/b19-16-/t12-/m1/s1 |
| InChIKey | LQQHABDLXWXWMJ-QCJHYCHESA-N |
| XLogP | 4.49 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|