C20H19N3OS — CID 135764347
(Z,4S)-2-(1H-benzimidazol-2-yl)-4-(2,4-dimethylphenyl)sulfanyl-3-hydroxypent-2-enenitrile (PubChem CID 135764347) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is (Z,4S)-2-(1H-benzimidazol-2-yl)-4-(2,4-dimethylphenyl)sulfanyl-3-hydroxypent-2-enenitrile.
| Compound Name | (Z,4S)-2-(1H-benzimidazol-2-yl)-4-(2,4-dimethylphenyl)sulfanyl-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135764347 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (Z,4S)-2-(1H-benzimidazol-2-yl)-4-(2,4-dimethylphenyl)sulfanyl-3-hydroxypent-2-enenitrile |
| SMILES | Cc1ccc(S[C@@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)c(C)c1 |
| InChI | InChI=1S/C20H19N3OS/c1-12-8-9-18(13(2)10-12)25-14(3)19(24)15(11-21)20-22-16-6-4-5-7-17(16)23-20/h4-10,14,24H,1-3H3,(H,22,23)/b19-15-/t14-/m0/s1 |
| InChIKey | QHWNSPBXIOUUJK-SQQITKIUSA-N |
| XLogP | 5.15 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|