C22H24N5O2+ — CID 135722613
[(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium (PubChem CID 135722613) has the molecular formula C22H24N5O2+ and a molecular weight of 390.47 g/mol. Its IUPAC name is [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium.
| Compound Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 135722613 |
| Molecular Formula | C22H24N5O2+ |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](C)[C@@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H23N5O2/c1-14-8-10-16(11-9-14)24-20(28)13-27(3)15(2)21(29)17(12-23)22-25-18-6-4-5-7-19(18)26-22/h4-11,15,29H,13H2,1-3H3,(H,24,28)(H,25,26)/p+1/b21-17-/t15-/m0/s1 |
| InChIKey | DVLAPTXNIWPNCU-MUNYZGMTSA-O |
| XLogP | 2.21 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|