C22H24N5O2+ — CID 135779728
[(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium (PubChem CID 135779728) has the molecular formula C22H24N5O2+ and a molecular weight of 390.47 g/mol. Its IUPAC name is [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium.
| Compound Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 135779728 |
| Molecular Formula | C22H24N5O2+ |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](C)C/C(O)=C(\C#N)c2nc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C22H23N5O2/c1-15-8-10-16(11-9-15)24-21(29)14-26(2)13-20(28)17(12-23)22-25-18-6-4-5-7-19(18)27(22)3/h4-11,28H,13-14H2,1-3H3,(H,24,29)/p+1/b20-17- |
| InChIKey | MPKWUGMCKQNQCJ-JZJYNLBNSA-O |
| XLogP | 1.83 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|