C19H21N4O2+ — CID 2462072
[2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium (PubChem CID 2462072) has the molecular formula C19H21N4O2+ and a molecular weight of 337.40 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2462072 |
| Molecular Formula | C19H21N4O2+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C19H20N4O2/c1-14-7-9-16(10-8-14)21-18(24)12-23(2)13-19(25)22-17-6-4-3-5-15(17)11-20/h3-10H,12-13H2,1-2H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | SJEAINZRCVVYIF-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |