C15H21N4O2+ — CID 2496920
[2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium (PubChem CID 2496920) has the molecular formula C15H21N4O2+ and a molecular weight of 289.36 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
|---|---|
| PubChem CID | 2496920 |
| Molecular Formula | C15H21N4O2+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
| SMILES | CCCNC(=O)C[NH+](C)CC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C15H20N4O2/c1-3-8-17-14(20)10-19(2)11-15(21)18-13-7-5-4-6-12(13)9-16/h4-7H,3,8,10-11H2,1-2H3,(H,17,20)(H,18,21)/p+1 |
| InChIKey | ABCYCNLZOLWLOD-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |