C16H23N4O2+ — CID 9302664
[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium (PubChem CID 9302664) has the molecular formula C16H23N4O2+ and a molecular weight of 303.39 g/mol. Its IUPAC name is [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium.
| Compound Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9302664 |
| Molecular Formula | C16H23N4O2+ |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
| SMILES | CCCNC(=O)C[NH+](C)[C@H](C)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C16H22N4O2/c1-4-9-18-15(21)11-20(3)12(2)16(22)19-14-8-6-5-7-13(14)10-17/h5-8,12H,4,9,11H2,1-3H3,(H,18,21)(H,19,22)/p+1/t12-/m1/s1 |
| InChIKey | CYJAENIVAYUPDS-GFCCVEGCSA-O |
| XLogP | -0.07 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |