C16H22N4O2 — CID 9302665
(2R)-N-(2-cyanophenyl)-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]propanamide (PubChem CID 9302665) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R)-N-(2-cyanophenyl)-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]propanamide.
| Compound Name | (2R)-N-(2-cyanophenyl)-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 9302665 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2R)-N-(2-cyanophenyl)-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]propanamide |
| SMILES | CCCNC(=O)CN(C)[C@H](C)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C16H22N4O2/c1-4-9-18-15(21)11-20(3)12(2)16(22)19-14-8-6-5-7-13(14)10-17/h5-8,12H,4,9,11H2,1-3H3,(H,18,21)(H,19,22)/t12-/m1/s1 |
| InChIKey | CYJAENIVAYUPDS-GFCCVEGCSA-N |
| XLogP | 1.34 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |