C20H23N3O — CID 8515756
(2R)-N-(2-cyanophenyl)-2-[(4-ethylphenyl)methyl-methylamino]propanamide (PubChem CID 8515756) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (2R)-N-(2-cyanophenyl)-2-[(4-ethylphenyl)methyl-methylamino]propanamide.
| Compound Name | (2R)-N-(2-cyanophenyl)-2-[(4-ethylphenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 8515756 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2R)-N-(2-cyanophenyl)-2-[(4-ethylphenyl)methyl-methylamino]propanamide |
| SMILES | CCc1ccc(CN(C)[C@H](C)C(=O)Nc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C20H23N3O/c1-4-16-9-11-17(12-10-16)14-23(3)15(2)20(24)22-19-8-6-5-7-18(19)13-21/h5-12,15H,4,14H2,1-3H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | WDODCTMKAHCAGT-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |