C19H22N3O2+ — CID 8514381
[(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium (PubChem CID 8514381) has the molecular formula C19H22N3O2+ and a molecular weight of 324.40 g/mol. Its IUPAC name is [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8514381 |
| Molecular Formula | C19H22N3O2+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)[C@@H](C)C(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-14(19(23)21-18-10-5-4-8-16(18)12-20)22(2)13-15-7-6-9-17(11-15)24-3/h4-11,14H,13H2,1-3H3,(H,21,23)/p+1/t14-/m0/s1 |
| InChIKey | FEBUFVGZRUFYFC-AWEZNQCLSA-O |
| XLogP | 1.61 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |