C14H21N2O4+ — CID 8789047
[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium (PubChem CID 8789047) has the molecular formula C14H21N2O4+ and a molecular weight of 281.33 g/mol. Its IUPAC name is [(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8789047 |
| Molecular Formula | C14H21N2O4+ |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | [(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]-[(3-methoxyphenyl)methyl]-methylazanium |
| SMILES | COC(=O)NC(=O)[C@H](C)[NH+](C)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-10(13(17)15-14(18)20-4)16(2)9-11-6-5-7-12(8-11)19-3/h5-8,10H,9H2,1-4H3,(H,15,17,18)/p+1/t10-/m0/s1 |
| InChIKey | OAFLUOLPSUMIGA-JTQLQIEISA-O |
| XLogP | -0.02 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |