C22H31N2O2+ — CID 8789058
(3-methoxyphenyl)methyl-methyl-[2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl]azanium (PubChem CID 8789058) has the molecular formula C22H31N2O2+ and a molecular weight of 355.50 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl-methyl-[2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl]azanium.
| Compound Name | (3-methoxyphenyl)methyl-methyl-[2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl]azanium |
|---|---|
| PubChem CID | 8789058 |
| Molecular Formula | C22H31N2O2+ |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (3-methoxyphenyl)methyl-methyl-[2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl]azanium |
| SMILES | COc1cccc(C[NH+](C)CC(=O)NCCc2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C22H30N2O2/c1-17(2)20-10-8-18(9-11-20)12-13-23-22(25)16-24(3)15-19-6-5-7-21(14-19)26-4/h5-11,14,17H,12-13,15-16H2,1-4H3,(H,23,25)/p+1 |
| InChIKey | SRKBDXZTXNDJAZ-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |