C21H26N3O2+ — CID 8789196
[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium (PubChem CID 8789196) has the molecular formula C21H26N3O2+ and a molecular weight of 352.46 g/mol. Its IUPAC name is [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8789196 |
| Molecular Formula | C21H26N3O2+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)CC(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-24(14-16-6-5-7-18(12-16)26-2)15-21(25)22-11-10-17-13-23-20-9-4-3-8-19(17)20/h3-9,12-13,23H,10-11,14-15H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | NTDTWIQJCDROFO-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |