C21H26N3O+ — CID 8564281
benzyl-ethyl-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]azanium (PubChem CID 8564281) has the molecular formula C21H26N3O+ and a molecular weight of 336.46 g/mol. Its IUPAC name is benzyl-ethyl-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]azanium.
| Compound Name | benzyl-ethyl-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8564281 |
| Molecular Formula | C21H26N3O+ |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | benzyl-ethyl-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)NCCc1c[nH]c2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C21H25N3O/c1-2-24(15-17-8-4-3-5-9-17)16-21(25)22-13-12-18-14-23-20-11-7-6-10-19(18)20/h3-11,14,23H,2,12-13,15-16H2,1H3,(H,22,25)/p+1 |
| InChIKey | JANXGQVZHYLIMX-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |