C15H15BrN3OS+ — CID 9299186
(5-bromothiophen-2-yl)methyl-[2-(2-cyanoanilino)-2-oxoethyl]-methylazanium (PubChem CID 9299186) has the molecular formula C15H15BrN3OS+ and a molecular weight of 365.28 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-[2-(2-cyanoanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-[2-(2-cyanoanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9299186 |
| Molecular Formula | C15H15BrN3OS+ |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-[2-(2-cyanoanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1C#N)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H14BrN3OS/c1-19(9-12-6-7-14(16)21-12)10-15(20)18-13-5-3-2-4-11(13)8-17/h2-7H,9-10H2,1H3,(H,18,20)/p+1 |
| InChIKey | BNXFZWCEGFCMNS-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |