C15H17BrN3O2S+ — CID 9299369
(5-bromothiophen-2-yl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium (PubChem CID 9299369) has the molecular formula C15H17BrN3O2S+ and a molecular weight of 383.29 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9299369 |
| Molecular Formula | C15H17BrN3O2S+ |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(C(N)=O)cc1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H16BrN3O2S/c1-19(8-12-6-7-13(16)22-12)9-14(20)18-11-4-2-10(3-5-11)15(17)21/h2-7H,8-9H2,1H3,(H2,17,21)(H,18,20)/p+1 |
| InChIKey | LJVIEHXARFDBGR-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |