C19H23BrN3O2+ — CID 9039953
(4-bromophenyl)methyl-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylazanium (PubChem CID 9039953) has the molecular formula C19H23BrN3O2+ and a molecular weight of 405.32 g/mol. Its IUPAC name is (4-bromophenyl)methyl-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylazanium.
| Compound Name | (4-bromophenyl)methyl-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9039953 |
| Molecular Formula | C19H23BrN3O2+ |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (4-bromophenyl)methyl-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylazanium |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)C[NH+](C)Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H22BrN3O2/c1-22(2)19(25)15-6-10-17(11-7-15)21-18(24)13-23(3)12-14-4-8-16(20)9-5-14/h4-11H,12-13H2,1-3H3,(H,21,24)/p+1 |
| InChIKey | OTPPKUIEKHRZGE-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |