C16H17BrFN2O+ — CID 8908958
[2-(4-bromoanilino)-2-oxoethyl]-[(3-fluorophenyl)methyl]-methylazanium (PubChem CID 8908958) has the molecular formula C16H17BrFN2O+ and a molecular weight of 352.23 g/mol. Its IUPAC name is [2-(4-bromoanilino)-2-oxoethyl]-[(3-fluorophenyl)methyl]-methylazanium.
| Compound Name | [2-(4-bromoanilino)-2-oxoethyl]-[(3-fluorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8908958 |
| Molecular Formula | C16H17BrFN2O+ |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | [2-(4-bromoanilino)-2-oxoethyl]-[(3-fluorophenyl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(Br)cc1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H16BrFN2O/c1-20(10-12-3-2-4-14(18)9-12)11-16(21)19-15-7-5-13(17)6-8-15/h2-9H,10-11H2,1H3,(H,19,21)/p+1 |
| InChIKey | VMDAAPXWNQQHSN-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |