C17H17F4N2O+ — CID 8961732
(3-fluorophenyl)methyl-methyl-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]azanium (PubChem CID 8961732) has the molecular formula C17H17F4N2O+ and a molecular weight of 341.33 g/mol. Its IUPAC name is (3-fluorophenyl)methyl-methyl-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]azanium.
| Compound Name | (3-fluorophenyl)methyl-methyl-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8961732 |
| Molecular Formula | C17H17F4N2O+ |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (3-fluorophenyl)methyl-methyl-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(C(F)(F)F)cc1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H16F4N2O/c1-23(10-12-3-2-4-14(18)9-12)11-16(24)22-15-7-5-13(6-8-15)17(19,20)21/h2-9H,10-11H2,1H3,(H,22,24)/p+1 |
| InChIKey | DOEOAJZKSCEFSR-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |