C21H28N3O2+ — CID 8018592
(4-tert-butylphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium (PubChem CID 8018592) has the molecular formula C21H28N3O2+ and a molecular weight of 354.47 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (4-tert-butylphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8018592 |
| Molecular Formula | C21H28N3O2+ |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (4-tert-butylphenyl)methyl-[2-(4-carbamoylanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(C(N)=O)cc1)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27N3O2/c1-21(2,3)17-9-5-15(6-10-17)13-24(4)14-19(25)23-18-11-7-16(8-12-18)20(22)26/h5-12H,13-14H2,1-4H3,(H2,22,26)(H,23,25)/p+1 |
| InChIKey | XHMKNYAJGGGELX-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |