C17H21N2OS+ — CID 9199091
(2-anilino-2-oxoethyl)-methyl-[(4-methylsulfanylphenyl)methyl]azanium (PubChem CID 9199091) has the molecular formula C17H21N2OS+ and a molecular weight of 301.44 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl)-methyl-[(4-methylsulfanylphenyl)methyl]azanium.
| Compound Name | (2-anilino-2-oxoethyl)-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9199091 |
| Molecular Formula | C17H21N2OS+ |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2-anilino-2-oxoethyl)-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
| SMILES | CSc1ccc(C[NH+](C)CC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2OS/c1-19(12-14-8-10-16(21-2)11-9-14)13-17(20)18-15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | KHRQXOIFHJXPTK-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |