C15H25N2OS+ — CID 8767584
[2-(tert-butylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium (PubChem CID 8767584) has the molecular formula C15H25N2OS+ and a molecular weight of 281.45 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8767584 |
| Molecular Formula | C15H25N2OS+ |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
| SMILES | CSc1ccc(C[NH+](C)CC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24N2OS/c1-15(2,3)16-14(18)11-17(4)10-12-6-8-13(19-5)9-7-12/h6-9H,10-11H2,1-5H3,(H,16,18)/p+1 |
| InChIKey | COPKFGSNRWQYGU-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |