C14H21N2O3S+ — CID 9198856
[2-(ethoxycarbonylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium (PubChem CID 9198856) has the molecular formula C14H21N2O3S+ and a molecular weight of 297.40 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9198856 |
| Molecular Formula | C14H21N2O3S+ |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
| SMILES | CCOC(=O)NC(=O)C[NH+](C)Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-4-19-14(18)15-13(17)10-16(2)9-11-5-7-12(20-3)8-6-11/h5-8H,4,9-10H2,1-3H3,(H,15,17,18)/p+1 |
| InChIKey | KADQRJDEQJPKJM-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |