C16H26N3O2S+ — CID 2699452
[2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium (PubChem CID 2699452) has the molecular formula C16H26N3O2S+ and a molecular weight of 324.47 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 2699452 |
| Molecular Formula | C16H26N3O2S+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
| SMILES | CSc1ccc(C[NH+](C)CC(=O)NC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O2S/c1-16(2,3)18-15(21)17-14(20)11-19(4)10-12-6-8-13(22-5)9-7-12/h6-9H,10-11H2,1-5H3,(H2,17,18,20,21)/p+1 |
| InChIKey | XYLICQILPYWJRC-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |