C13H17F3N3O2+ — CID 8710176
methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium (PubChem CID 8710176) has the molecular formula C13H17F3N3O2+ and a molecular weight of 304.29 g/mol. Its IUPAC name is methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium.
| Compound Name | methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 8710176 |
| Molecular Formula | C13H17F3N3O2+ |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium |
| SMILES | CNC(=O)NC(=O)C[NH+](C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3N3O2/c1-17-12(21)18-11(20)8-19(2)7-9-3-5-10(6-4-9)13(14,15)16/h3-6H,7-8H2,1-2H3,(H2,17,18,20,21)/p+1 |
| InChIKey | WAKQMBBALMUIHB-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |