C13H18F2N3O3+ — CID 8709316
[4-(difluoromethoxy)phenyl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 8709316) has the molecular formula C13H18F2N3O3+ and a molecular weight of 302.30 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | [4-(difluoromethoxy)phenyl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8709316 |
| Molecular Formula | C13H18F2N3O3+ |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]methyl-methyl-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)NC(=O)C[NH+](C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H17F2N3O3/c1-16-13(20)17-11(19)8-18(2)7-9-3-5-10(6-4-9)21-12(14)15/h3-6,12H,7-8H2,1-2H3,(H2,16,17,19,20)/p+1 |
| InChIKey | RZPAHIGHXVCWMX-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |